| Identification | |
| Name: | 3-Thiophenecarboxylicacid, 4-methoxy-, methyl ester |
| Synonyms: | 4-Methoxy-3-thiophenecarboxylicacid methyl ester; Methyl 4-methoxythiophene-3-carboxylate |
| CAS: | 65369-22-4 |
| Molecular Formula: | C7H8 O3 S |
| Molecular Weight: | 172.2 |
| InChI: | InChI=1/C7H8O3S/c1-9-6-4-11-3-5(6)7(8)10-2/h3-4H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 70 °C |
| Flash Point: | 103.9°C |
| Boiling Point: | 248.1°C at 760 mmHg |
| Density: | 1.222g/cm3 |
| Refractive index: | 1.524 |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | 103.9°C |
| Safety Data | |
 |
|
