| Identification | |
| Name: | Isopentyl 4-methoxycinnamate |
| Synonyms: | 4-Methoxycinnamicacid 2-isoamyl ester;4-Methoxycinnamic acid isoamyl ester;Amiloxate;3-(4-Methoxyphenyl)-2-propenoic acid, 3-methylbutyl ester;Isoamyl 4-methoxycinnamate;Isoamyl methoxycinnamate;Isoamylp-methoxycinnamate; |
| CAS: | 71617-10-2 |
| EINECS: | 275-702-5 |
| Molecular Formula: | C15H20O3 |
| Molecular Weight: | 248.32 |
| InChI: | InChI=1/C15H20O3/c1-12(2)10-11-18-15(16)9-6-13-4-7-14(17-3)8-5-13/h4-9,12H,10-11H2,1-3H3/b9-6+ |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.031 g/cm3 |
| Refractive index: | 1.524 |
| Specification: |
Isopentyl 4-methoxycinnamate , with CAS number of 14611-52-0, can be called 2-Benzoic acid, 2-propenoic acid, 3-(4-methoxyphenyl)-3-methylbutyl ester ; 3-(4-Methoxyphenyl)-2-propenoic acid, 3-methylbutyl ester ; 3-Methylbutyl 3-(4-methoxyphenyl)-2-propenoate ; Isoamyl p-methoxycinnamate ; Amiloxate [USAN] . |
| Safety Data | |
 |
|
