| Identification | |
| Name: | 4-Piperidinecarboxylicacid, 1-methyl-, hydrochloride (1:1) |
| Synonyms: | N-Methylpiperidine-4-carboxylic acid hydrochloride; |
| CAS: | 71985-80-3 |
| Molecular Formula: | C7H13NO2.ClH |
| Molecular Weight: | 179.64 |
| InChI: | InChI=1/C7H13NO2.ClH/c1-8-4-2-6(3-5-8)7(9)10;/h6H,2-5H2,1H3,(H,9,10);1H |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 226-228°C (dec.) |
| Flash Point: | 102.6°C |
| Boiling Point: | 246.1°C at 760 mmHg |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Flash Point: | 102.6°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
