| Identification | |
| Name: | 4-Piperidinecarboxylicacid, methyl ester, hydrochloride (1:1) |
| Synonyms: | 4-Piperidinecarboxylicacid, methyl ester, hydrochloride (9CI); Methyl isonipecotate hydrochloride;Methyl piperidine-4-carboxylate hydrochloride |
| CAS: | 7462-86-4 |
| Molecular Formula: | C7H13 N O2 . Cl H |
| Molecular Weight: | 143.18 |
| InChI: | InChI=1/C7H13NO2.ClH/c1-10-7(9)6-2-4-8-5-3-6;/h6,8H,2-5H2,1H3;1H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.06 |
| Refractive index: | 1.465 |
| Specification: |
Methyl 4-piperidinecarboxylate , with CAS number of 7462-86-4, can be called 4-piperidinecarboxylic acid, methyl ester ; Methyl piperidin-4-carboxylate ; Methyl piperidine-4-carboxylate ; Methylpiperidin-4-carboxylat . |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
