| Identification |
| Name: | 1H-Indole-3-aceticacid, a-(aminomethyl)-5-methoxy-, methylester, hydrochloride (1:1) |
| Synonyms: | 1H-Indole-3-aceticacid, a-(aminomethyl)-5-methoxy-, methylester, monohydrochloride (9CI); Indorenate hydrochloride; TR 3369 |
| CAS: | 72318-55-9 |
| Molecular Formula: | C13H16 N2 O3 . Cl H |
| Molecular Weight: | 284.73868 |
| InChI: | InChI=1/C13H16N2O3.ClH/c1-17-8-3-4-12-9(5-8)11(7-15-12)10(6-14)13(16)18-2;/h3-5,7,10,15H,6,14H2,1-2H3;1H |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 221.6°C |
| Boiling Point: | 442.8°C at 760 mmHg |
| Biological Activity: | 5-HT receptor agonist with high affinity for 5-HT 1A receptors (pK d = 7.8) and lower affinity for 5-HT 1B and 5-HT 2C receptors (pK d values are 5.44 and 6.49 respectively). Possesses anti-hypertensive, anxiolytic and anorectic activity in vivo . |
| Flash Point: | 221.6°C |
| Storage Temperature: | Desiccate at RT |
| Safety Data |
| |
 |
