Identification |
Name: | 2-Propenoic acid, 2-methyl-, dodecyl ester, polymer with butyl 2-propenoate |
Synonyms: | 2-Propenoic acid, 2-methyl-, dodecyl ester, polymer with butyl 2-propenoate |
CAS: | 73018-97-0 |
Molecular Formula: | C23H42O4 |
Molecular Weight: | 0 |
InChI: | InChI=1/C16H30O2.C7H12O2/c1-4-5-6-7-8-9-10-11-12-13-14-18-16(17)15(2)3;1-3-4-5-6(2)7(8)9/h2,4-14H2,1,3H3;2-5H2,1H3,(H,8,9) |
Molecular Structure: |
 |
Properties |
Flash Point: | 133.8°C |
Boiling Point: | 322.7°C at 760 mmHg |
Density: | g/cm3 |
Flash Point: | 133.8°C |
Safety Data |
|
 |