| Identification | |
| Name: | 2-Amino-5-methylthiazole |
| Synonyms: | 2-Thiazolamine, 5-methyl-;2 AMINO 5 METHYL THIAZOLE;2-Amino-5-Methyl Thiozole;5-methylthiophen-2-amine;2-AMINO-5-METHYLTHIAZOLE 99%;5-methyl-1,3-thiazol-2-amine;Thiazole, 2-amino-5-methyl-;2-Amino-5-inethylthiazole; |
| CAS: | 7305-71-7 |
| EINECS: | 423-800-5 |
| Molecular Formula: | C4H6N2S |
| Molecular Weight: | 114.17 |
| InChI: | InChI=1/C4H6N2S/c1-3-2-6-4(5)7-3/h2H,1H3,(H2,5,6) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2811 |
| Density: | 1.258 g/cm3 |
| Refractive index: | 1.618 |
| Appearance: | Light yellow powder |
| Specification: | white to light yellow crystal powde Safety Statements:60-61-29-26-37/39 60:This material and/or its container must be disposed of as hazardous waste 61:Avoid release to the environment. Refer to special instructions safety data sheet 29:Do not empty into drains 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Packinggroup: | III |
| HS Code: | 29341000 |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
