| Identification | |
| Name: | 2-Thiophenecarboxylicacid, 3-bromo- |
| Synonyms: | 3-Bromothiophene-2-carboxylic acid |
| CAS: | 7311-64-0 |
| EINECS: | -0 |
| Molecular Formula: | C5H3BrO2S |
| Molecular Weight: | 207.04 |
| InChI: | InChI=1/C5H3BrO2S/c6-3-1-2-9-4(3)5(7)8/h1-2H,(H,7,8)/p-1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.923 g/cm3 |
| Appearance: | white to light yellow crystal powder |
| Specification: | white to light yellow crystal powder Safety Statements:36/37-37/39-26 36/37:Wear suitable protective clothing and gloves 37/39:Wear suitable protective clothing, gloves and eye/face protection 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
