Identification |
Name: | Geldanamycin,6,17-didemethoxy-15-methoxy-6-methyl-11-O-methyl-, (15R)- |
Synonyms: | 2-Azabicyclo[16.3.1]docosane,geldanamycin deriv.; (+)-Macbecin I; Macbecin; Macbecin I; NSC 330499 |
CAS: | 73341-72-7 |
Molecular Formula: | C30H42 N2 O8 |
Molecular Weight: | 0 |
InChI: | InChI=1/C30H42N2O8/c1-16-10-9-11-17(2)29(35)32-23-15-21(33)14-22(25(23)34)27(38-7)20(5)13-24(37-6)28(39-8)19(4)12-18(3)26(16)40-30(31)36/h9-12,14-16,19-20,24,26-28H,13H2,1-8H3,(H2,31,36)(H,32,35)/b10-9+,17-11-,18-12+ |
Molecular Structure: |
|
Properties |
Flash Point: | 399°C |
Boiling Point: | 736.2°C at 760 mmHg |
Density: | 1.17g/cm3 |
Refractive index: | 1.545 |
Biological Activity: | Ansamycin antibiotic compound that inhibits Hsp90 activity (IC 50 = 2 μ M) by binding to the ATP-binding site. Exhibits antitumor and cytocidal activities (IC 50 ~ 0.4 μ M) by causing degradation of key oncogenic client proteins such as ErbB2 and cRaf1. Displays higher affinity and potency than geldanamycin (9,13-Dihydroxy-8,14,19-trimethoxy-4,10,12,16-tetramethyl-2-azabicyclo[16.3.1]docosa-4,6,10,18,21-pentaene-3,20,22-trione, 9-carbamate ). |
Flash Point: | 399°C |
Safety Data |
|
|