| Identification | |
| Name: | 4-((4-(Diethylamino)phenyl)azo)pyridine-1-oxide |
| Synonyms: | 4-[[4-(Diethylamino)phenyl]azo]pyridine 1-oxide |
| CAS: | 7347-49-1 |
| Molecular Formula: | C15H18N4O |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C15H18N4O/c1-3-18(4-2)15-7-5-13(6-8-15)16-17-14-9-11-19(20)12-10-14/h5-12H,3-4H2,1-2H3/b17-16+ |
| Molecular Structure: | ![(C15H18N4O) 4-[[4-(Diethylamino)phenyl]azo]pyridine 1-oxide](https://img.guidechem.com/crawlimg/7347-49-1.png) |
| Properties | |
| Flash Point: | 257.6°C |
| Boiling Point: | 502.3°C at 760 mmHg |
| Density: | 1.1g/cm3 |
| Refractive index: | 1.579 |
| Specification: |
4-((4-(Diethylamino)phenyl)azo)pyridine-1-oxide ,with CAS number of 7347-49-1,can be called N,N-Diethyl-4-(4'-(pyridyl-1'-oxide)azo)aniline . |
| Report: |
4-((4-(Diethylamino)phenyl)azo)pyridine-1-oxide ,with CAS number of 7347-49-1,can be called N,N-Diethyl-4-(4'-(pyridyl-1'-oxide)azo)aniline . |
| Flash Point: | 257.6°C |
| Safety Data | |
 |
|
