| Identification | |
| Name: | Acetic acid,2-hydroxy-, butyl ester |
| Synonyms: | Aceticacid, hydroxy-, butyl ester (9CI);Glycolic acid, butyl ester (6CI,7CI,8CI);Butoxycarbonylmethanol;Butyl hydroxyacetate;Polysolvan O;n-Butyl glycolate; |
| CAS: | 7397-62-8 |
| EINECS: | 230-991-7 |
| Molecular Formula: | C6H12O3 |
| Molecular Weight: | 132.16 |
| InChI: | InChI=1/C6H12O3/c1-2-3-4-9-6(8)5-7/h7H,2-5H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 200kgs |
| Density: | 1.027 g/cm3 |
| Refractive index: | 1.427 |
| Appearance: | clear liquid |
| Specification: |
Acetic acid,2-hydroxy-, butyl ester , its cas register number 7397-62-8. It also can be called Polysolvan 0 ; Butyl glycolate ; and Butyl hydroxyacetate . |
| Safety Data | |
 |
|
