| Identification | |
| Name: | 6-Pteridinemethanol,2,4-diamino-, hydrochloride (1:1) |
| Synonyms: | 6-Pteridinemethanol,2,4-diamino-, monohydrochloride (9CI);2,4-Diamino-6-(hydroxymethyl)pteridine hydrochloride;2,4-Diaminopyrimido[4,5-b]pyrazine-6-methanol monohydrochloride; |
| CAS: | 73978-41-3 |
| EINECS: | 213-412-2 |
| Molecular Formula: | C7H9ClN6O |
| Molecular Weight: | 246.65 |
| InChI: | InChI=1/C7H8N6O.ClH.H2O/c8-5-4-6(13-7(9)12-5)10-1-3(2-14)11-4;;/h1,14H,2H2,(H4,8,9,10,12,13);1H;1H2 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 220 °C(lit.) |
| Flash Point: | 338.8°C |
| Boiling Point: | 636.5°C at 760 mmHg |
| Specification: | white to light yellow crystal powde usageEng:Methotrexate intermediate. Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Flash Point: | 338.8°C |
| Usage: | Methotrexate intermediate. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
