| Identification | |
| Name: | dibenzylamine, compound with boron trifluoride (1:1) |
| Synonyms: | Boron, trifluoro(N-(phenylmethyl)benzenemethanamine)-, (T-4)-;Boron trifluoridedibenzylamine complex;Dibenzylamine, boron trifluoride complex (1:1);Boron, trifluoro(N-(phenylmethyl)benzenemethanamine)-, (beta-4)-;Dibenzylamine, compound with boron trifluoride (1:1);boron fluoride - N-benzyl-1-phenylmethanamine (1:3:1) |
| CAS: | 7445-38-7 |
| EINECS: | 231-192-6 |
| Molecular Formula: | C14H15BF3N |
| Molecular Weight: | 265.0818 |
| InChI: | InChI=1/C14H15N.B.3FH/c1-3-7-13(8-4-1)11-15-12-14-9-5-2-6-10-14;;;;/h1-10,15H,11-12H2;;3*1H/q;+3;;;/p-3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 143.3°C |
| Boiling Point: | 300°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 143.3°C |
| Safety Data | |
 |
|
