| Identification | |
| Name: | Acetamide,N-(3-acetylphenyl)- |
| Synonyms: | Acetanilide,3'-acetyl- (6CI);1-[3-(Acetylamino)phenyl]ethanone;3-Acetamidoacetophenone;3-Acetylacetanilide;3'-(Acetylamino)acetophenone;N-(3-Acetylphenyl)acetamide;NSC 404340;m-Acetamidoacetophenone; |
| CAS: | 7463-31-2 |
| Molecular Formula: | C10H11NO2 |
| Molecular Weight: | 177.2 |
| InChI: | InChI=1/C10H11NO2/c1-7(12)9-4-3-5-10(6-9)11-8(2)13/h3-6H,1-2H3,(H,11,13) |
| Molecular Structure: | ![(C10H11NO2) Acetanilide,3'-acetyl- (6CI);1-[3-(Acetylamino)phenyl]ethanone;3-Acetamidoacetophenone;3-Acetylaceta...](https://img.guidechem.com/casimg/7463-31-2.gif) |
| Properties | |
| Flash Point: | 172.6°C |
| Boiling Point: | 381.5°C at 760 mmHg |
| Density: | 1.15g/cm3 |
| Refractive index: | 1.57 |
| Appearance: | cream to brown crystalline powder |
| Specification: | cream to brown crystalline powder Safety Statements:26-36-24/25 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 24/25:Avoid contact with skin and eyes |
| Flash Point: | 172.6°C |
| Safety Data | |
 |
|
