| Identification | |
| Name: | 8-Bromomethylquinoline |
| Synonyms: | 8-Quinolinylmethyl bromide;8-Quinolylmethyl bromide;NSC 405282;Fluticasone propionate;Quinoline,8-(bromomethyl)-; |
| CAS: | 7496-46-0 |
| Molecular Formula: | C10H8BrN |
| Molecular Weight: | 222.08 |
| InChI: | InChI=1/C10H8BrN/c11-7-9-4-1-3-8-5-2-6-12-10(8)9/h1-6H,7H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3261 |
| Flash Point: | 148.5 °C |
| Boiling Point: | 321.9 °C at 760 mmHg |
| Density: | 1.518 g/cm3 |
| Refractive index: | 1.673 |
| Appearance: | 3261 |
| Specification: | Safety Statements:26-36/37/39-45-24/25-22 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 24/25:Avoid contact with skin and eyes 22:Do not breathe dust |
| Flash Point: | 148.5 °C |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
