| Identification | |
| Name: | 1H-Imidazole-5-ethanamine,a-methyl-, (aR)- |
| Synonyms: | 1H-Imidazole-4-ethanamine,a-methyl-, (R)-;1H-Imidazole-4-ethanamine, a-methyl-, (aR)-(9CI); (R)-(-)-a-Methylhistamine;(R)-a-Methylhistamine; (aR)-a-Methyl-1H-imidazole-4-ethanamine; RAMH |
| CAS: | 75614-87-8 |
| Molecular Formula: | C6H11 N3 |
| Molecular Weight: | 125.1716 |
| InChI: | InChI=1/C6H11N3/c1-5(7)2-6-3-8-4-9-6/h3-5H,2,7H2,1H3,(H,8,9)/t5-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.094 g/cm3 |
| Refractive index: | 1.55 |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Biological Activity: | Very potent, high affinity H 3?agonist (K D = 50.3 nM) that displays > 200-fold selectivity over H 4 receptors. Inhibits H 3 -mediated histamine synthesis and release in the CNS and stimulates H 4 -mediated eosinophil shape change (EC 50 = 66 nM). Also available as part of the Histamine H 3 Receptor Tocriset™ . |
| Storage Temperature: | Desiccate at RT |
| Color: | white to off-white |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
