| Identification | |
| Name: | 1H-Imidazole-5-ethanamine,a-methyl-, (aS)- |
| Synonyms: | 1H-Imidazole-4-ethanamine,a-methyl-, (S)-;1H-Imidazole-4-ethanamine, a-methyl-, (aS)-(9CI); (S)-a-Methylhistamine; S-(+)-a-Methylhistamine |
| CAS: | 75614-93-6 |
| Molecular Formula: | C6H11 N3 |
| Molecular Weight: | 287 |
| InChI: | InChI=1/C6H11N3.2BrH/c1-5(7)2-6-3-8-4-9-6;;/h3-5H,2,7H2,1H3,(H,8,9);2*1H/t5-;;/m0../s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 181.1°C |
| Boiling Point: | 375.8°C at 760 mmHg |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Biological Activity: | Less active enantiomer of H 3 agonist R-(-)- α -methylhistamine ((R)-(-)-a-Methyl-1H-imidazole-4-ethanaminedihydrobromide ); 120-fold less potent than R-(-) at H 3 . |
| Flash Point: | 181.1°C |
| Storage Temperature: | Desiccate at RT |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
