| Identification | |
| Name: | 3,4-Dichloro-1-butene |
| Synonyms: | 3,4-Dichlorobutene-1 (racemic mixture);1,2-Dichloro-3-butene (racemic mixture);4-01-00-00772 (Beilstein Handbook Reference);1-Butene, 3,4-dichloro- (racemic mixture);3,4-Dichlorobut-1-ene;3,4-Dichlorobutene-1;64037-54-3;1-Butene, 3,4-dichloro-, (+-)-; |
| CAS: | 760-23-6 |
| EINECS: | 212-079-0 |
| Molecular Formula: | C4H6Cl2 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C4H6Cl2/c1-2-4(6)3-5/h2,4H,1,3H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2920 8/PG 2 |
| Melting Point: | −61 °C(lit.) |
| Flash Point: | 83 °F |
| Boiling Point: | 123 °C(lit.) |
| Density: | 1.15 g/mL at 25 °C(lit.) |
| Refractive index: | n20/D 1.4658(lit.) |
| Solubility: | 420 mg/l of water; soluble in polar solvents. Soluble in ethanol, ether and benzene Very soluble in benzene and chloroform. |
| Specification: |
3,4-Dichloro-1-butene (760-23-6) is yellow - colorless clear liquid, known as 1,2-Dichloro-3-butene ; 1,2-Dichloro-3-butene (racemic mixture) ; 1-Butene, 3,4-dichloro- ; 3,4-Dichlorobutene-1 (racemic mixture) ; 4-01-00-00772 (Beilstein Handbook Reference) ; CCRIS 8555 ; HSDB 5751 ; 1-Butene, 3,4-dichloro- (racemic mixture) ; 3,4-Dichlorobut-1-ene . It is incompatible with strong oxidizing agents, strong bases. When heated to decomposition, it yields Hydrogen chloride , Carbon monoxide , Carbon dioxide . |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Flash Point: | 83 °F |
| Storage Temperature: | 0-6°C |
| Color: | COLORLESS LIQ |
| Safety Data | |
 |
|
