| Identification |
| Name: | 2-Ethylhexanoyl chloride |
| Synonyms: | - |
| CAS: | 760-67-8 |
| EINECS: | 212-081-1 |
| Molecular Formula: | C8H15ClO |
| Molecular Weight: | 162.66 |
| InChI: | InChI=1/C8H15ClO/c1-3-5-6-7(4-2)8(9)10/h7H,3-6H2,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 3265 |
| Density: | 0.939 |
| Stability: | No data. |
| Refractive index: | 1.4315-1.4335 |
| Water Solubility: | Decomposes in water |
| Solubility: | Decomposes in water |
| Appearance: | Clear to slightly greyish liquid. |
| Packinggroup: | II |
| HS Code: | 29159080 |
| Storage Temperature: | Keep away from sources of ignition. Store in a cool, dry place. Store in a tightly closed container. Corrosives area. |
| Sensitive: | Moisture Sensitive |
| Safety Data |
| Hazard Symbols |
C:Corrosive
|
| |
 |
