| Identification | |
| Name: | Benzenamine,4-[2-(4-isothiocyanatophenyl)diazenyl]-N,N-dimethyl- |
| Synonyms: | Benzenamine,4-[(4-isothiocyanatophenyl)azo]-N,N-dimethyl- (9CI); Isothiocyanic acid,p-[[p-(dimethylamino)phenyl]azo]phenyl ester (6CI,7CI,8CI); Aniline,p-[(p-isothiocyanatophenyl)azo]-N,N-dimethyl- (8CI);4-Dimethylamino-4'-isothiocyanatoazobenzene;4-Dimethylaminophenylazophenyl-4'-isothiocyanate;4-N,N-Dimethylaminoazobenzene-4'-isothiocyanate;4'-Dimethylaminoazobenzene-4-isothiocyanate; DABITC |
| CAS: | 7612-98-8 |
| EINECS: | 231-521-3 |
| Molecular Formula: | C15H14 N4 S |
| Molecular Weight: | 282.37 |
| InChI: | InChI=1/C15H14N4S/c1-19(2)15-9-7-14(8-10-15)18-17-13-5-3-12(4-6-13)16-11-20/h3-10H,1-2H3/b18-17+ |
| Molecular Structure: | ![(C15H14N4S) Benzenamine,4-[(4-isothiocyanatophenyl)azo]-N,N-dimethyl- (9CI); Isothiocyanic acid,p-[[p-(dimethyla...](https://img.guidechem.com/crawlimg/7612-98-8.jpg) |
| Properties | |
| Melting Point: | 167-171 °C(lit.) |
| Flash Point: | 235.7°C |
| Boiling Point: | 466.2°C at 760 mmHg |
| Density: | 1.13g/cm3 |
| Refractive index: | 1.612 |
| Specification: | Rust crystalline powder Safety Statements:22-24/25 22:Do not breathe dust 24/25:Avoid contact with skin and eyes |
| Flash Point: | 235.7°C |
| Sensitive: | Moisture Sensitive |
| Safety Data | |
 |
|
