| Identification | |
| Name: | 2-Pentanol, 5-chloro-,(R)- (9CI) |
| Synonyms: | (-)-5-Chloro-2-pentanol |
| CAS: | 76188-95-9 |
| Molecular Formula: | C5H11 Cl O |
| Molecular Weight: | 122.59 |
| InChI: | InChI=1/C5H11ClO/c1-5(7)3-2-4-6/h5,7H,2-4H2,1H3/t5-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1987 3/PG 3 |
| Flash Point: | 79.7°C |
| Boiling Point: | 174.5°C at 760 mmHg |
| Density: | 1.094 g/mL at 20 °C(lit.) |
| Refractive index: | 1.437 |
| Specification: | Safety Statements:23-24/25 23:Do not breathe gas/fumes/vapor/spray (appropriate wording to be specified by the manufacturer) 24/25:Avoid contact with skin and eyes |
| Flash Point: | 79.7°C |
| Storage Temperature: | 2-8°C |
| Safety Data | |
 |
|
