Identification |
Name: | 2-Pentanol, 5-chloro-,(R)- (9CI) |
Synonyms: | (-)-5-Chloro-2-pentanol |
CAS: | 76188-95-9 |
Molecular Formula: | C5H11 Cl O |
Molecular Weight: | 122.59 |
InChI: | InChI=1/C5H11ClO/c1-5(7)3-2-4-6/h5,7H,2-4H2,1H3/t5-/m0/s1 |
Molecular Structure: |
 |
Properties |
Transport: | UN 1987 3/PG 3 |
Flash Point: | 79.7°C |
Boiling Point: | 174.5°C at 760 mmHg |
Density: | 1.094 g/mL at 20 °C(lit.) |
Refractive index: | 1.437 |
Specification: | Safety Statements:23-24/25 23:Do not breathe gas/fumes/vapor/spray (appropriate wording
to be specified by the manufacturer) 24/25:Avoid contact with skin and eyes |
Flash Point: | 79.7°C |
Storage Temperature: | 2-8°C |
Safety Data |
|
 |