| Identification | |
| Name: | (R)-(-)-2-Pentanol |
| Synonyms: | (R)-2-Pentanol; |
| CAS: | 31087-44-2 |
| EINECS: | 256-810-1 |
| Molecular Formula: | C5H12O |
| Molecular Weight: | 88.15 |
| InChI: | InChI=1/C5H12O/c1-3-4-5(2)6/h5-6H,3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1105 |
| Flash Point: | 93? |
| Density: | 0.809 |
| Refractive index: | 1.406 |
| Appearance: | Colorless to light yellow liquid |
| Specification: |
(R)-(-)-2-Pentanol ,its cas register number is 31087-44-2. It also can be called Methyl propyl carbinol ; 2-Hydroxypentane ; sec-Pentyl alcohol and sec-Amyl alcohol . |
| Flash Point: | 93? |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
