| Identification | |
| Name: | (S)-(+)-2-Pentanol |
| Synonyms: | (S)-Pentan-2-ol |
| CAS: | 26184-62-3 |
| EINECS: | 227-907-6 |
| Molecular Formula: | C5H12O |
| Molecular Weight: | 88.15 |
| InChI: | InChI=1/C5H12O/c1-3-4-5(2)6/h5-6H,3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1105 |
| Melting Point: | -50 °C |
| Density: | 0.812 |
| Refractive index: | 1.405-1.407 |
| Alpha: | 13 º (C=NEAT) |
| Water Solubility: | soluble |
| Solubility: | soluble |
| Appearance: | Colorless to light yellow liquid |
| Specification: |
2-Pentanol,(2S)- , its CAS NO. is 26184-62-3, the synonym is (S)-(+)-2-Pentanol . |
| Packinggroup: | III |
| Storage Temperature: | Flammables area |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
