| Identification | |
| Name: | 1,2,4-Triazolo[4,3-a]pyridin-3-amine |
| Synonyms: | s-Triazolo[4,3-a]pyridine,3-amino- (7CI,8CI); NSC 76010 |
| CAS: | 767-62-4 |
| Molecular Formula: | C6H6 N4 |
| Molecular Weight: | 134.14 |
| InChI: | InChI=1/C6H6N4/c7-6-9-8-5-3-1-2-4-10(5)6/h1-4H,(H2,7,9) |
| Molecular Structure: | ![(C6H6N4) s-Triazolo[4,3-a]pyridine,3-amino- (7CI,8CI); NSC 76010](https://img1.guidechem.com/chem/e/dict/38/767-62-4.jpg) |
| Properties | |
| Density: | 1.5g/cm3 |
| Refractive index: | 1.773 |
| Specification: |
The 1,2,4-Triazolo[4,3-a]pyridin-3-amine, with the cas registry number 767-62-4, is also called (1,2,4)Triazolo(4,3-a)pyridin-3(2H)-imine. And the molecular formula of the chemical is C6H6N4. The characteristics of this chemical are as followings: (1)ACD/LogP: 0.42; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 7.4): 0.41; (4)ACD/BCF (pH 5.5): 1; (5)ACD/BCF (pH 7.4): 1.2; (6)ACD/KOC (pH 5.5): 14.64; (7)ACD/KOC (pH 7.4): 39.52; (8)#H bond acceptors: 4; (9)#H bond donors: 2; (10)#Freely Rotating Bonds: 0; (11)Polar Surface Area: 33.43 Å2; (12)Index of Refraction: 1.773; (13)Molar Refractivity: 37.07 cm3; (14)Molar Volume: 88.9 cm3; (15)Polarizability: 14.69×10-24cm3; (16)Surface Tension: 70 dyne/cm; (17)Density: 1.5 g/cm3. Addtionally, the following datas could be converted into the molecular structure: |
| Safety Data | |
 |
|
