The 2,6-Difluoro-4-methoxybenzylamine with the cas number 771573-20-7 is also called benzenemethanamine, 2,6-difluoro-4-methoxy-. The IUPAC name is (2,6-difluoro-4-methoxyphenyl)methanamine. Its molecular formula is C8H9F2NO. Product's category is METHOXY.This chemical is sensitive to air.
The properties of the chemical are: (1)ACD/LogP: 1.25; (2)# of Rule of 5 Violations: 0 ; (3)#H bond acceptors: 2; (4)#H bond donors: 2; (5)#Freely Rotating Bonds: 3; (6)Polar Surface Area: 12.47 Å2; (7)Index of Refraction: 1.495; (8)Molar Refractivity: 41.37 cm3; (9)Molar Volume: 141.8 cm3; (10)Polarizability: 16.4×10-24cm3; (11)Surface Tension: 34.6 dyne/cm; (12)Enthalpy of Vaporization: 43.49 kJ/mol; (13)Vapour Pressure: 0.355 mmHg at 25°C.
You can still convert the following datas into molecular structure:
(1)SMILES: Fc1c(c(F)cc(OC)c1)CN
(2)InChI: InChI=1/C8H9F2NO/c1-12-5-2-7(9)6(4-11)8(10)3-5/h2-3H,4,11H2,1H3
(3)InChIKey: ALINWWVXTNYKIM-UHFFFAOYAX
|