2,3-Difluoro-4-methoxybenzylamine (886500-75-0)

The 2,3-Difluoro-4-methoxybenzylamine with the cas number 886500-75-0 is also called Benzenemethanamine,2,3-difluoro-4-methoxy-. The systematic name is 1-(2,3-difluoro-4-methoxyphenyl)methanamine. Its molecular formula is C₈H₉F₂NO. This chemical is sensitive to air.

The properties of the chemical are: (1)ACD/LogP: 1.02; (2)# of Rule of 5 Violations: 0; (3)#H bond acceptors: 2; (4)#H bond donors: 2; (5)#Freely Rotating Bonds: 3; (6)Polar Surface Area: 12.47 Å²; (7)Index of Refraction: 1.495; (8)Molar Refractivity: 41.37 cm³; (9)Molar Volume: 141.8 cm³; (10)Polarizability: 16.4×10^-24cm³; (11)Surface Tension: 34.6 dyne/cm; (12)Enthalpy of Vaporization: 45.96 kJ/mol; (13)Vapour Pressure: 0.0982 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: Fc1c(F)c(ccc1OC)CN
(2)InChI: InChI=1/C8H9F2NO/c1-12-6-3-2-5(4-11)7(9)8(6)10/h2-3H,4,11H2,1H3
(3)InChIKey: DBQHLJOOMYBKNQ-UHFFFAOYAQ