| Identification | |
| Name: | 1,4-Anhydro-D-mannitol |
| Synonyms: | 1,4-Anhydro-D-mannitol;1,4-Mannitan |
| CAS: | 7726-97-8 |
| Molecular Formula: | C6H12O5 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C6H12O5/c7-1-3(8)6-5(10)4(9)2-11-6/h3-10H,1-2H2/t3?,4?,5?,6-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 221.445°C |
| Boiling Point: | 442.547°C at 760 mmHg |
| Density: | 1.573g/cm3 |
| Refractive index: | 1.597 |
| Specification: | White Solid usageEng:A carbohydrate metabolism regulator that has been shown to inhibit gluconeogenesis from lactate plus pyruvate and from substrates that enter the gluconeogenic pathway as triose phosphate. |
| Flash Point: | 221.445°C |
| Usage: | A carbohydrate metabolism regulator that has been shown to inhibit gluconeogenesis from lactate plus pyruvate and from substrates that enter the gluconeogenic pathway as triose phosphate. |
| Safety Data | |
 |
|
