| Identification | |
| Name: | Propanoic acid,2-chloro-, methyl ester, (2R)- |
| Synonyms: | Propanoicacid, 2-chloro-, methyl ester, (R)-; (+)-2-Chloropropionic acid methyl ester;(+)-Methyl 2-chloropropanoate; (+)-Methyl 2-chloropropionate; (+)-Methyl a-chloropropionate; (R)-(+)-Methyl2-chloropropionate; (R)-2-Chloropropanoic acid methyl ester;(R)-2-Chloropropionic acid methyl ester; Methyl (R)-2-chloropropionate |
| CAS: | 77287-29-7 |
| EINECS: | 278-658-5 |
| Molecular Formula: | C4H7 Cl O2 |
| Molecular Weight: | 122.55 |
| InChI: | InChI=1/C4H7ClO2/c1-3(5)4(6)7-2/h3H,1-2H3/t3-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2933 |
| Flash Point: | 99 oF |
| Boiling Point: | 132-134 oC |
| Density: | 1.152 |
| Refractive index: | 1.417 |
| Alpha: | 26 o (NEAT) |
| Specification: |
Methyl (R)-2-chloropropionate , its cas register number is 77287-29-7. It also can be called (R)-(+)-Methyl (R)-2-chloropropionate ; (R)-(+)-2-Chloropropionic acid methyl ester . |
| Flash Point: | 99 oF |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
