Identification |
Name: | 3H-Imidazo[4,5-f]quinolin-2-amine,N-hydroxy-3-methyl- |
Synonyms: | 2H-Imidazo[4,5-f]quinolin-2-one,1,3-dihydro-3-methyl-, oxime (9CI); 2-Hydroxyamino-3-methylimidazo[4,5-f]quinoline;N-Hydroxy-IQ |
CAS: | 77314-23-9 |
Molecular Formula: | C11H10 N4 O |
Molecular Weight: | 214.25 |
InChI: | InChI=1/C11H10N4O/c1-15-9-5-4-8-7(3-2-6-12-8)10(9)13-11(15)14-16/h2-6,16H,1H3,(H,13,14) |
Molecular Structure: |
![(C11H10N4O) 2H-Imidazo[4,5-f]quinolin-2-one,1,3-dihydro-3-methyl-, oxime (9CI); 2-Hydroxyamino-3-methylimidazo[4...](https://img1.guidechem.com/chem/e/dict/0/77314-23-9.jpg) |
Properties |
Flash Point: | 250.3°C |
Boiling Point: | 490.3°C at 760 mmHg |
Density: | 1.47g/cm3 |
Stability: | Light Sensitive |
Refractive index: | 1.751 |
Specification: | Light Pink Solid usageEng:2-Hydroxy derivative of the mutagenic heterocyclic amine, IQ |
Flash Point: | 250.3°C |
Storage Temperature: | Amber Vial, -20?C Freezer, Under Inert Atmosphere |
Usage: | 2-Hydroxy derivative of the mutagenic heterocyclic amine, IQ |
Safety Data |
|
 |