| Identification | |
| Name: | 3H-Imidazo[4,5-f]quinolin-2-amine,3-(methyl-d3)- (9CI) |
| Synonyms: | 2-Amino-3-methyl-3H-imidazo[4,5-F]quinoline-d3 |
| CAS: | 82050-10-0 |
| Molecular Formula: | C11H7 D3 N4 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C11H10N4/c1-15-9-5-4-8-7(3-2-6-13-8)10(9)14-11(15)12/h2-6H,1H3,(H2,12,14)/i1D3 |
| Molecular Structure: | ![(C11H7D3N4) 2-Amino-3-methyl-3H-imidazo[4,5-F]quinoline-d3](https://img1.guidechem.com/chem/e/dict/1/82050-10-0.jpg) |
| Properties | |
| Flash Point: | 231.2°C |
| Boiling Point: | 458.7°C at 760 mmHg |
| Density: | 1.43g/cm3 |
| Refractive index: | 1.754 |
| Specification: | Light Brown Crystals usageEng:IQ is highly mutagenic in the Ames test. Investigations have shown that this compound may be present in broiled fish, fried beef, commercial beef extracts and protein pyrolysates. |
| Flash Point: | 231.2°C |
| Storage Temperature: | Refrigerator |
| Usage: | IQ is highly mutagenic in the Ames test. Investigations have shown that this compound may be present in broiled fish, fried beef, commercial beef extracts and protein pyrolysates. |
| Safety Data | |
 |
|
