| Identification |
| Name: | 3-Bromo-4-fluorobenzaldehyde |
| Synonyms: | Benzaldehyde, 3-bromo-4-fluoro-;4--bromo-3-fluorobenzaldehyde;4-Fluoro-3-bromobenzaldehyde;3-bromo-4-fluoro-benzaldehyde;4-fluoro-3- bromobenzaldehyde; |
| CAS: | 77771-02-9 |
| EINECS: | 278-764-1 |
| Molecular Formula: | C7H4BrFO |
| Molecular Weight: | 203.01 |
| InChI: | InChI=1/C7H4BrFO/c8-6-3-5(4-10)1-2-7(6)9/h1-4H |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 311.9 oC at 760 mmHg |
| Density: | 1.67 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.574 |
| Water Solubility: | INSOLUBLE |
| Solubility: | Insoluble |
| Appearance: | white to light yellow low melting solid |
| Flash Point: | 311.9 oC at 760 mmHg |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Do not expose to air. Store under an inert atmosphere. |
| Sensitive: | Air Sensitive |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
