| Identification |
| Name: | isobutyl oleate, compound with sulphuric acid |
| Synonyms: | 9-Octadecenoic acid (9Z)-, 2-methylpropyl ester, compd. with sulfuric acid (1:?);9-Octadecenoic acid (9Z)-, 2-methylpropyl ester, compd. with sulfuric acid;Isobutyl oleate, compound with sulphuric acid;2-methylpropyl (9Z)-octadec-9-enoate - sulfuric acid (1:1) |
| CAS: | 7779-99-9 |
| EINECS: | 231-946-4 |
| Molecular Formula: | C22H44O6S |
| Molecular Weight: | 436.6462 |
| InChI: | InChI=1/C22H42O2.H2O4S/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22(23)24-20-21(2)3;1-5(2,3)4/h11-12,21H,4-10,13-20H2,1-3H3;(H2,1,2,3,4)/b12-11-; |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 87.4°C |
| Boiling Point: | 411.2°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 87.4°C |
| Safety Data |
| |
 |
