| Identification |
| Name: | sulphuric acid, compound with 2H-1-benzopyran-2-one (1:1) |
| Synonyms: | Sulfuric acid, compd. with 2H-1-benzopyran-2-one (1:1);1-Benzopyrylium, 2-hydroxy-, bisulfate salt;Sulphuric acid, compound with 2H-1-benzopyran-2-one (1:1);2H-chromen-2-one - sulfuric acid (1:1) |
| CAS: | 77902-86-4 |
| EINECS: | 278-789-8 |
| Molecular Formula: | C9H8O6S |
| Molecular Weight: | 244.2212 |
| InChI: | InChI=1/C9H6O2.H2O4S/c10-9-6-5-7-3-1-2-4-8(7)11-9;1-5(2,3)4/h1-6H;(H2,1,2,3,4) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 118.3°C |
| Boiling Point: | 298°C at 760 mmHg |
| Flash Point: | 118.3°C |
| Safety Data |
| |
 |
