| Identification | |
| Name: | Pyridine,2-(2-pyrrolidinyl)- |
| CAS: | 77790-61-5 |
| Molecular Formula: | C9H12 N2 |
| Molecular Weight: | 148.20768 |
| InChI: | InChI=1/C9H12N2/c1-2-6-10-8(4-1)9-5-3-7-11-9/h1-2,4,6,9,11H,3,5,7H2/p+1/t9-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN2810 |
| Flash Point: | 112.4°C |
| Boiling Point: | 262.3°C at 760 mmHg |
| Density: | 1.042 |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Packinggroup: | III |
| Flash Point: | 112.4°C |
| Safety Data | |
 |
|
