| Identification |
| Name: | 3-Pyridinecarboxylicacid, 1,6-dihydro-6-oxo-1-phenyl-, methyl ester |
| Synonyms: | Nicotinicacid, 1,6-dihydro-6-oxo-1-phenyl-, methyl ester (7CI); Methyl6-oxo-1-phenyl-1,6-dihydropyridine-3-carboxylate |
| CAS: | 77837-09-3 |
| Molecular Formula: | C13H11 N O3 |
| Molecular Weight: | 229.23 |
| InChI: | InChI=1/C13H11NO3/c1-17-13(16)10-7-8-12(15)14(9-10)11-5-3-2-4-6-11/h2-9H,1H3 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 177.58°C |
| Boiling Point: | 370.016°C at 760 mmHg |
| Density: | 1.271g/cm3 |
| Refractive index: | 1.596 |
| Flash Point: | 177.58°C |
| Usage: | A metabolite of Pirfenidone, a new drug to treat patients with kidney disease who have diabetes |
| Safety Data |
| |
 |
