| Identification | |
| Name: | Benzamide,4-amino-N-phenyl- |
| Synonyms: | Benzanilide,4-amino- (6CI,7CI,8CI);4-Amino-N-phenylbenzamide;4-Aminobenzanilide;N-Phenyl-4-aminobenzamide; |
| CAS: | 782-45-6 |
| EINECS: | 212-313-1 |
| Molecular Formula: | C13H12N2O |
| Molecular Weight: | 212.25 |
| InChI: | InChI=1S/C13H12N2O/c14-11-8-6-10(7-9-11)13(16)15-12-4-2-1-3-5-12/h1-9H,14H2,(H,15,16) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 127-131 °C(lit.) |
| Flash Point: | 148.1 °C |
| Boiling Point: | 321.2 °C at 760 mmHg |
| Density: | 1.244 g/cm3 |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Flash Point: | 148.1 °C |
| Safety Data | |
 |
|
