| Identification | |
| Name: | Hexanamide,N-(2-chloro-6-methylphenyl)-2-(ethylamino)-, hydrochloride (1:1) |
| Synonyms: | Hexanamide,N-(2-chloro-6-methylphenyl)-2-(ethylamino)-, monohydrochloride (9CI);o-Hexanotoluidide, 6'-chloro-2-ethylamino-, monohydrochloride (6CI) |
| CAS: | 78265-90-4 |
| Molecular Formula: | C15H23 Cl N2 O . Cl H |
| Molecular Weight: | 319.31 |
| InChI: | InChI=1/C15H23ClN2O.ClH/c1-4-6-10-13(17-5-2)15(19)18-14-11(3)8-7-9-12(14)16;/h7-9,13,17H,4-6,10H2,1-3H3,(H,18,19);1H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 201.7°C |
| Boiling Point: | 409.8°C at 760 mmHg |
| Specification: |
C 3208 (CAS NO.78265-90-4) is also called 6'-Chloro-2-(ethylamino)-o-hexanotoluidide hydrochloride ; o-Hexanotoluidide, 6'-chloro-2-(ethylamino)-, hydrochloride . C 3208 (CAS NO.78265-90-4) is high toxic. It will produce toxic nitrogen oxides and chlorine fumes by heat. So the storage environment should be ventilate, low-temperature and dry. Keep C 3208 (CAS NO.78265-90-4) separate from raw materials of food. |
| Flash Point: | 201.7°C |
| Safety Data | |
 |
|
