| Identification | |
| Name: | Dichloroacetic acid |
| Synonyms: | Dichloroacetic acid solution |
| CAS: | 79-43-6 |
| EINECS: | 201-207-0 |
| Molecular Formula: | C2H2Cl2O2 |
| Molecular Weight: | 128.94 |
| InChI: | InChI=1/C2H2Cl2O2/c3-1(4)2(5)6/h1H,(H,5,6) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1764 |
| Density: | 1.575 |
| Stability: | Stable. Incompatible with strong oxidizing agents, strong bases, strong reducing agents. Reacts with water. Protect from moisture. Hygroscopic. |
| Refractive index: | 1.4653-1.4673 |
| Water Solubility: | soluble |
| Solubility: | soluble in water |
| Appearance: | clear colorless to light yellow liquid |
| Specification: |
2,2-Dichloroacetic acid , with CAS number of 79-43-6, can be called Dichloroacetic aciol ; Dichloroethanoic acid ; Dichloroacetic acid ; Dichlorethanoic acid ; Dichloracetic acid ; Aceticacid, dichloro- (5CI,8CI,9CI) . It is stable but incompatible with strong oxidizing agents, strong bases, strong reducing agents. 2,2-Dichloroacetic acid (CAS NO.79-43-6) is used as a pesticide, pharmaceutical intermediates, organic synthesis. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | II |
| Sensitive: | Hygroscopic |
| Color: | Colorless liquid |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
