| Identification | |
| Name: | 1-Naphthalenamine,4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydro-N-methyl-, (1R,4S)-rel- |
| CAS: | 79836-45-6 |
| Molecular Formula: | C17H17 Cl2 N |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C17H17Cl2N/c1-20-17-9-7-12(13-4-2-3-5-14(13)17)11-6-8-15(18)16(19)10-11/h2-6,8,10,12,17,20H,7,9H2,1H3/t12-,17+/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 205.589°C |
| Boiling Point: | 416.33°C at 760 mmHg |
| Density: | 1.255g/cm3 |
| Refractive index: | 1.621 |
| Specification: | Yellow Oil usageEng:Used for the treatment of menopause and mood, anxiety, and cognitive disorders. They block uptake of dopamine and norepinephrine |
| Flash Point: | 205.589°C |
| Storage Temperature: | Refrigerator |
| Usage: | Used for the treatment of menopause and mood, anxiety, and cognitive disorders. They block uptake of dopamine and norepinephrine |
| Safety Data | |
 |
|
