| Identification |
| Name: | Benzene,1-ethynyl-4-pentyl- |
| Synonyms: | 4-Pentylphenylacetylene; |
| CAS: | 79887-10-8 |
| Molecular Formula: | C13H16 |
| Molecular Weight: | 172.27 |
| InChI: | InChI=1/C13H16/c1-3-5-6-7-13-10-8-12(4-2)9-11-13/h2,8-11H,3,5-7H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 218? |
| Density: | 0.885 |
| Refractive index: | 1.523 |
| Appearance: | colourless to pale yellow transparent liquid |
| Flash Point: | 218? |
| Storage Temperature: | Store Cold |
| Sensitive: | Light Sensitive |
| Usage: | Intermediates of Liquid Crystals |
| Safety Data |
| Hazard Symbols |
F: Flammable
|
| |
 |
