| Identification |
| Name: | Benzene,1-ethynyl-4-methyl- |
| Synonyms: | Toluene,p-ethynyl- (6CI,7CI,8CI);(4-Methylphenyl)ethyne;(p-Methylphenyl)ethyne;1-Ethynyl-4-methylbenzene;1-Methyl-4-ethynylbenzene;4-Ethynyltoluene;4-Methylethynylbenzene;4-Methylphenylacetylene;4-Tolylacetylene;p-Ethynyltoluene;p-Methylphenylacetylene;p-Tolylacetylene;p-Tolylethyne; |
| CAS: | 766-97-2 |
| Molecular Formula: | C9H8 |
| Molecular Weight: | 116.16 |
| InChI: | InChI=1/C9H8/c1-3-9-6-4-8(2)5-7-9/h1,4-7H,2H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 3295 |
| Melting Point: | 168-170ºC |
| Density: | 0.916 |
| Stability: | No data. |
| Refractive index: | 1.547 |
| Water Solubility: | Nonsoluble in water. Fully miscible with toluene, soluble in ethanol, acetone, dichloromethane , hexane |
| Solubility: | Nonsoluble in water. Fully miscible with toluene, soluble in ethanol, acetone, dichloromethane , hexane |
| Appearance: | Clear colourless or light yellow liquid, on standing crystallizes |
| Packinggroup: | III |
| Storage Temperature: | Keep Cold |
| Usage: | Intermediates of Liquid Crystals |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
