| Identification |
| Name: | Benzene,1-ethynyl-3-methyl- |
| Synonyms: | Toluene,m-ethynyl- (6CI,7CI,8CI);(3-Methylphenyl)ethyne;1-Ethynyl-3-methylbenzene;1-Methyl-3-ethynylbenzene;3-Methylphenylacetylene;3-Tolylacetylene;m-Ethynyltoluene;m-Methylphenylacetylene;m-Tolylacetylene; |
| CAS: | 766-82-5 |
| EINECS: | -0 |
| Molecular Formula: | C9H8 |
| Molecular Weight: | 116.16 |
| InChI: | InChI=1/C9H8/c1-3-9-6-4-5-8(2)7-9/h1,4-7H,2H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 1993 |
| Density: | 0.9 |
| Refractive index: | 1.5440 |
| Water Solubility: | Immiscible with water |
| Solubility: | Immiscible with water |
| Appearance: | Clear light yellow to brown liquid |
| Packinggroup: | III |
| Storage Temperature: | Flammables area |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
