| Identification | |
| Name: | Benzene,1-ethynyl-3-methoxy- |
| Synonyms: | Anisole,m-ethynyl- (6CI,7CI,8CI);1-Ethynyl-3-methoxybenzene;1-Methoxy-3-ethynylbenzene;3-Ethynylanisole;3-Methoxyphenylacetylene;3-Methoxyphenylethyne;m-Anisylacetylene;m-Ethynylanisole;m-Methoxyphenylacetylene;m-Methoxyphenylethyne; |
| CAS: | 768-70-7 |
| Molecular Formula: | C9H8O |
| Molecular Weight: | 132.16 |
| InChI: | InChI=1/C9H8O/c1-3-8-5-4-6-9(7-8)10-2/h1,4-7H,2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 77 ºC |
| Density: | 1.04 |
| Refractive index: | 1.555 |
| Specification: |
The 3-Ethynylanisole with the cas number 768-70-7 is also called Benzene,1-ethynyl-3-methoxy-. Both the systematic name and IUPAC name are 1-ethynyl-3-methoxybenzene. Its molecular formula is C9H8O. This chemical is a kind of organics. It should be stored in dry and cool environment. The properties of the chemical are: (1)ACD/LogP: 2.32; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 2.32; (4)ACD/LogD (pH 7.4): 2.32; (5)ACD/BCF (pH 5.5): 33.86; (6)ACD/BCF (pH 7.4): 33.86; (7)ACD/KOC (pH 5.5): 433.07; (8)ACD/KOC (pH 7.4): 433.07; (9)#H bond acceptors: 1; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 1; (12)Polar Surface Area: 9.23 Å2; (13)Index of Refraction: 1.53; (14)Molar Refractivity: 40.17 cm3; (15)Molar Volume: 130 cm3; (16)Polarizability: 15.92×10-24cm3; (17)Surface Tension: 37.4 dyne/cm; (18)Enthalpy of Vaporization: 42.26 kJ/mol; (19)Vapour Pressure: 0.377 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Flash Point: | 77 ºC |
| Safety Data | |
 |
|
