| Identification | |
| Name: | Benzene,1-ethynyl-3-nitro- |
| Synonyms: | (m-Nitrophenyl)ethyne;1-Ethynyl-3-nitrobenzene;3-Nitroethynylbenzene;3-Nitrophenylacetylene;m-Nitrophenylacetylene; |
| CAS: | 3034-94-4 |
| EINECS: | 221-232-0 |
| Molecular Formula: | C8H5NO2 |
| Molecular Weight: | 147.13 |
| InChI: | InChI=1/C8H5NO2/c1-2-7-4-3-5-8(6-7)9(10)11/h1,3-6H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.22g/cm3 |
| Refractive index: | 1.579 |
| Specification: |
The 3-Nitrophenylacetylene ,its cas register number is 3034-94-4.It also can be called as 1-Ethynyl-3-nitrobenzene and the IUPAC name about this chemical is 1-Ethynyl-3-nitrobenzene .It belongs to the pharmacetical. Preparation Products about this chemical is 3-Aminophenylacetylene . Following are the chemical properties about 3-Nitrophenylacetylene :(1)#H bond acceptors: 3 ; (2)#H bond donors: 0 ; (3)#Freely Rotating Bonds: 1 ; (4)Polar Surface Area: 45.82Å2 ; (5)Index of Refraction: 1.579 ; (6)Molar Refractivity: 39.84 cm3 ; (7)Molar Volume: 119.7 cm3 ; (8)Polarizability: 15.79x10-24cm3 ; (9)Surface Tension: 51.1 dyne/cm ; (10)Enthalpy of Vaporization: 45.57 kJ/mol ; (11)Vapour Pressure: 0.0664 mmHg at 25°C This chemical can be described computed from structure: |
| Safety Data | |
 |
|
