| Identification |
| Name: | 7-Oxabicyclo(2.2.1)heptane-2,3-dicarboxylic acid, disodium salt, mixture with 1-methylethyl phenylcarbamate |
| Synonyms: | MURBETOL;7-Oxabicyclo(2.2.1)heptane-2,3-dicarboxylic acid, disodium salt, mixt. with 1-methylethyl phenylcarbamate;8015-38-1;AC1L2NLR;LS-98736;7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid - propan-2-yl phenylcarbamate (1:1);7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid; propan-2-yl N-phenylcarbamate |
| CAS: | 8015-38-1 |
| Molecular Formula: | C10H13NO2 . C8H10O5 . 2Na |
| Molecular Weight: | 365.3777 |
| InChI: | InChI=1/C10H13NO2.C8H10O5/c1-8(2)13-10(12)11-9-6-4-3-5-7-9;9-7(10)5-3-1-2-4(13-3)6(5)8(11)12/h3-8H,1-2H3,(H,11,12);3-6H,1-2H2,(H,9,10)(H,11,12) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 87.7°C |
| Boiling Point: | 221.4°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 87.7°C |
| Safety Data |
| |
 |
