| Identification | |
| Name: | Propanoic acid,3-hydroxy-2-methyl-, methyl ester, (2S)- |
| Synonyms: | (S)-3-Hydroxy-2-methylpropanoic acid methyl ester;(2S)-3-Hydroxy-2-methylpropionic acid methyl ester;(+)-Methyl b-hydroxyisobutyrate;(S)-3-Hydroxy-2-methylpropionic acid methyl ester;Methyl (2S)-3-hydroxy-2-methylpropionate;Methyl (S)-b-hydroxyisobutyrate;Methyl(S)-3-hydroxy-2-methylpropionate;Methyl (2S)-3-hydroxy-2-methylpropanoate; |
| CAS: | 80657-57-4 |
| Molecular Formula: | C5H10O3 |
| Molecular Weight: | 118.13 |
| InChI: | InChI=1S/C5H10O3/c1-4(3-6)5(7)8-2/h4,6H,3H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 1993 |
| Flash Point: | 178 °F |
| Density: | 1.071 g/mL at 25 °C(lit.) |
| Refractive index: | n20/D 1.425 |
| Specification: | Safety Statements:26-36/37/39-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 36:Wear suitable protective clothing |
| Packinggroup: | III |
| Flash Point: | 178 °F |
| Safety Data | |
 |
|
