| Identification |
| Name: | Pyridine, 2-bromo-,1-oxide, hydrochloride (1:1) |
| Synonyms: | Pyridine,2-bromo-, 1-oxide, compd. with hydrochloric acid (7CI);Pyridine, 2-bromo-,1-oxide, hydrochloride (6CI,9CI);2-Bromopyridine 1-oxide hydrochloride; |
| CAS: | 80866-91-7 |
| EINECS: | 279-594-0 |
| Molecular Formula: | C5H4BrNO.HCl |
| Molecular Weight: | 210.46 |
| InChI: | InChI=1/C5H4BrNO.ClH/c6-5-3-1-2-4-7(5)8;/h1-4H;1H |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 157.1°C |
| Boiling Point: | 336.2°C at 760 mmHg |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Appearance: | Off-white powder. |
| Flash Point: | 157.1°C |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Hygroscopic |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
