Identification |
Name: | Pyridine, 2-bromo-,1-oxide, hydrochloride (1:1) |
Synonyms: | Pyridine,2-bromo-, 1-oxide, compd. with hydrochloric acid (7CI);Pyridine, 2-bromo-,1-oxide, hydrochloride (6CI,9CI);2-Bromopyridine 1-oxide hydrochloride; |
CAS: | 80866-91-7 |
EINECS: | 279-594-0 |
Molecular Formula: | C5H4BrNO.HCl |
Molecular Weight: | 210.46 |
InChI: | InChI=1/C5H4BrNO.ClH/c6-5-3-1-2-4-7(5)8;/h1-4H;1H |
Molecular Structure: |
 |
Properties |
Flash Point: | 157.1°C |
Boiling Point: | 336.2°C at 760 mmHg |
Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
Appearance: | Off-white powder. |
Flash Point: | 157.1°C |
Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
Sensitive: | Hygroscopic |
Safety Data |
Hazard Symbols |
Xi:Irritant
|
|
 |