| Identification |
| Name: | IMILOXAN HYDROCHLORIDE |
| Synonyms: | RS 21361;2-(1-ETHYL-2-IMIDAZOYL)METHYL-1,4-BENZODIOXAN HYDROCHLORIDE;2-[(2,3-DIHYDRO-1,4-BENZODIOXIN-2YL)METHYL]-1-ETHYL-1H-IMIDAZOLE HYDROCHLORIDE;IMILOXAN HYDROCHLORIDE;Imiloxan;2-(1-Ethyl-2-indazoyl)methyl-1,4-benzodioxanehydrochloride;ImiloxanHCl;RS 21361 HYDROCHLORIDE |
| CAS: | 81167-16-0 |
| Molecular Formula: | C14H17ClN2O2 |
| Molecular Weight: | 280.75 |
| InChI: | InChI=1/C14H16N2O2.ClH/c1-2-16-8-7-15-14(16)9-11-10-17-12-5-3-4-6-13(12)18-11;/h3-8,11H,2,9-10H2,1H3;1H |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 202.8°C |
| Boiling Point: | 411.7°C at 760 mmHg |
| Density: | 1.22g/cm3 |
| Biological Activity: | A moderately potent, but highly selective α 2 -adrenoceptor antagonist, the only reported selective antagonist at the α 2B -adrenoceptor not having potent α 1 -adrenoceptor antagonist activity. |
| Flash Point: | 202.8°C |
| Storage Temperature: | Desiccate at RT |
| Color: | white |
| Safety Data |
| |
 |
