| Identification | |
| Name: | 5-Cyanophthalide |
| Synonyms: | 1,3-Dihydro-1-oxoisobenzofuran-5-carbonitrile; |
| CAS: | 82104-74-3 |
| EINECS: | 279-900-2 |
| Molecular Formula: | C9H5NO2 |
| Molecular Weight: | 159.14 |
| InChI: | InChI=1/C9H5NO2/c10-4-6-1-2-8-7(3-6)5-12-9(8)11/h1-3H,5H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.36 g/cm3 |
| Refractive index: | 1.606 |
| Appearance: | white to pale yellow crystalline solid |
| Specification: |
?5-Cyanophthalide , its cas register number is 82104-74-3. It also can be called?1,3-Dihydro-1-oxoisobenzofuran-5-carbonitrile .It is a?white to pale yellow crystalline solid. |
| Usage: | A useful synthetic intermediate |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
