| Identification | |
| Name: | 8-Hydroxyquinaldine |
| Synonyms: | 2-Methyl-8-quinolinol; Hydroxyquinaldine,99%; 8-Hydroxy-2-methylquinoline; 2-Methyl-8-Hydroxyquinoline; 8-Hydroxyquinaldine~2-Methyl-8-quinolinol; 4-Hydroxy-3-quinoline carboxylic acid |
| CAS: | 826-81-3 |
| EINECS: | 212-562-6 |
| Molecular Formula: | C10H9NO |
| Molecular Weight: | 159.18 |
| InChI: | InChI=1/C10H9NO/c1-7-5-6-8-3-2-4-9(12)10(8)11-7/h2-6,12H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3077 |
| Density: | 1.21 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.596 (79 C) |
| Water Solubility: | insoluble |
| Solubility: | Insoluble |
| Appearance: | light yellow crystals |
| Specification: |
8-Hydroxy-2-methylquinoline (826-81-3) is used as an important pharmaceutical intermediate. It is also a useful analytical reagent. 8-Hydroxy-2-methylquinoline (826-81-3) is produced by the reaction of 2-Aminophenol and Crotonaldehyde .This compound is also called 2-Methyl-8-quinolino ; 8-Hydroxyqinaldine ; 8-Quinolinol,2-methyl- ; Hydroxyquinaldine ; 8-Hydroxy-2-methylquinoline ; 8-Hydroxyquinaldine ; 2-Methyl-8-hydroxyquinoline ; 2-Methyl-8-quinolinol . It is insoluble in water but can be soluble in Benzene , Aldehyde , Ether and other related organic solvents. It is stable under normal temperatures and pressures but it also should be stored in a tightly closed container when not in use and stored in a cool, dry,well-ventilated area away from incompatible substances. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| HS Code: | 29334990 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
N:Dangerousfortheenvironment
|
 |
|
